C17H16N2O3S2 — CID 2826149
N-[4-(1-benzothiophen-3-ylmethylsulfamoyl)phenyl]acetamide (PubChem CID 2826149) has the molecular formula C17H16N2O3S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[4-(1-benzothiophen-3-ylmethylsulfamoyl)phenyl]acetamide.
| Compound Name | N-[4-(1-benzothiophen-3-ylmethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 2826149 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | N-[4-(1-benzothiophen-3-ylmethylsulfamoyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCc2csc3ccccc23)cc1 |
| InChI | InChI=1S/C17H16N2O3S2/c1-12(20)19-14-6-8-15(9-7-14)24(21,22)18-10-13-11-23-17-5-3-2-4-16(13)17/h2-9,11,18H,10H2,1H3,(H,19,20) |
| InChIKey | GPWYBDGEWYSGMR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |