C15H13F3N2O3S — CID 74226496
N-[4-[(2,3,4-trifluorophenyl)methylsulfamoyl]phenyl]acetamide (PubChem CID 74226496) has the molecular formula C15H13F3N2O3S and a molecular weight of 358.34 g/mol. Its IUPAC name is N-[4-[(2,3,4-trifluorophenyl)methylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(2,3,4-trifluorophenyl)methylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 74226496 |
| Molecular Formula | C15H13F3N2O3S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-[4-[(2,3,4-trifluorophenyl)methylsulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H13F3N2O3S/c1-9(21)20-11-3-5-12(6-4-11)24(22,23)19-8-10-2-7-13(16)15(18)14(10)17/h2-7,19H,8H2,1H3,(H,20,21) |
| InChIKey | XQQPAOSIYCIMHW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|