C14H9F5N2O3S — CID 5193248
N-[4-[(2,3,4,5,6-pentafluorophenyl)sulfamoyl]phenyl]acetamide (PubChem CID 5193248) has the molecular formula C14H9F5N2O3S and a molecular weight of 380.29 g/mol. Its IUPAC name is N-[4-[(2,3,4,5,6-pentafluorophenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(2,3,4,5,6-pentafluorophenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 5193248 |
| Molecular Formula | C14H9F5N2O3S |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | N-[4-[(2,3,4,5,6-pentafluorophenyl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C14H9F5N2O3S/c1-6(22)20-7-2-4-8(5-3-7)25(23,24)21-14-12(18)10(16)9(15)11(17)13(14)19/h2-5,21H,1H3,(H,20,22) |
| InChIKey | GCLNGLJHXVNBQI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|