C15H14F2N2O5S2 — CID 2454469
N-[4-[[4-(difluoromethylsulfonyl)phenyl]sulfamoyl]phenyl]acetamide (PubChem CID 2454469) has the molecular formula C15H14F2N2O5S2 and a molecular weight of 404.42 g/mol. Its IUPAC name is N-[4-[[4-(difluoromethylsulfonyl)phenyl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-(difluoromethylsulfonyl)phenyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2454469 |
| Molecular Formula | C15H14F2N2O5S2 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | N-[4-[[4-(difluoromethylsulfonyl)phenyl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C15H14F2N2O5S2/c1-10(20)18-11-2-8-14(9-3-11)26(23,24)19-12-4-6-13(7-5-12)25(21,22)15(16)17/h2-9,15,19H,1H3,(H,18,20) |
| InChIKey | XRHKHCNDMAKAGI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |