C14H9F5N2O5S2 — CID 10789418
N-[4-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]phenyl]sulfonylacetamide (PubChem CID 10789418) has the molecular formula C14H9F5N2O5S2 and a molecular weight of 444.36 g/mol. Its IUPAC name is N-[4-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]phenyl]sulfonylacetamide.
| Compound Name | N-[4-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 10789418 |
| Molecular Formula | C14H9F5N2O5S2 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.99 |
| IUPAC Name | N-[4-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C14H9F5N2O5S2/c1-6(22)20-27(23,24)8-4-2-7(3-5-8)21-28(25,26)14-12(18)10(16)9(15)11(17)13(14)19/h2-5,21H,1H3,(H,20,22) |
| InChIKey | RNILEBAEQNIDBX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|