About bis([4-(acetylsulfamoyl)phenyl]azanide);dichloroplatinum(2+)
bis([4-(acetylsulfamoyl)phenyl]azanide);dichloroplatinum(2+) (PubChem CID 6102185) has the molecular formula C16H18Cl2N4O6PtS2
and a molecular weight of 692.46 g/mol. Its IUPAC name is bis([4-(acetylsulfamoyl)phenyl]azanide);dichloroplatinum(2+).
Molecular Properties
| Compound Name | bis([4-(acetylsulfamoyl)phenyl]azanide);dichloroplatinum(2+) |
| PubChem CID | 6102185 |
| Molecular Formula | C16H18Cl2N4O6PtS2 |
| Molecular Weight | 692.46 g/mol |
| Exact Mass | 690.97 |
| IUPAC Name | bis([4-(acetylsulfamoyl)phenyl]azanide);dichloroplatinum(2+) |
| SMILES | CC(=O)NS(=O)(=O)c1ccc([NH-])cc1.CC(=O)NS(=O)(=O)c1ccc([NH-])cc1.Cl[Pt+2]Cl |
| InChI | InChI=1S/2C8H9N2O3S.2ClH.Pt/c2*1-6(11)10-14(12,13)8-4-2-7(9)3-5-8;;;/h2*2-5,9H,1H3,(H,10,11);2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | FSKUTYUORDWVHK-UHFFFAOYSA-L |
| XLogP | 3.77 |
| TPSA | 174.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 692.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis([4-(acetylsulfamoyl)phenyl]azanide);dichloroplatinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis([4-(acetylsulfamoyl)phenyl]azanide);dichloroplatinum(2+)?
The IUPAC name of bis([4-(acetylsulfamoyl)phenyl]azanide);dichloroplatinum(2+) (CID 6102185) is bis([4-(acetylsulfamoyl)phenyl]azanide);dichloroplatinum(2+).
What is the SMILES notation for bis([4-(acetylsulfamoyl)phenyl]azanide);dichloroplatinum(2+)?
The canonical SMILES for bis([4-(acetylsulfamoyl)phenyl]azanide);dichloroplatinum(2+) is CC(=O)NS(=O)(=O)c1ccc([NH-])cc1.CC(=O)NS(=O)(=O)c1ccc([NH-])cc1.Cl[Pt+2]Cl.
What is the InChIKey of bis([4-(acetylsulfamoyl)phenyl]azanide);dichloroplatinum(2+)?
The InChIKey is FSKUTYUORDWVHK-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H9N2O3S.2ClH.Pt/c2*1-6(11)10-14(12,13)8-4-2-7(9)3-5-8;;;/h2*2-5,9H,1H3,(H,10,11);2*1H;/q2*-1;;;+4/p-2.
What are the key properties of bis([4-(acetylsulfamoyl)phenyl]azanide);dichloroplatinum(2+)?
bis([4-(acetylsulfamoyl)phenyl]azanide);dichloroplatinum(2+) has a molecular weight of 692.46 g/mol, XLogP of 3.77, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis([4-(acetylsulfamoyl)phenyl]azanide);dichloroplatinum(2+) is sourced from PubChem (CID 6102185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).