C16H16Cl2N2O6S2 — CID 139084564
N-(4-chlorophenyl)sulfonylacetamide (PubChem CID 139084564) has the molecular formula C16H16Cl2N2O6S2 and a molecular weight of 467.35 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfonylacetamide.
| Compound Name | N-(4-chlorophenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 139084564 |
| Molecular Formula | C16H16Cl2N2O6S2 |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 465.98 |
| IUPAC Name | N-(4-chlorophenyl)sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(Cl)cc1.CC(=O)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/2C8H8ClNO3S/c2*1-6(11)10-14(12,13)8-4-2-7(9)3-5-8/h2*2-5H,1H3,(H,10,11) |
| InChIKey | JDVLKSPZMKZIDR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |