C17H17ClN2O4S2 — CID 25034802
N-[4-(acetylsulfamoyl)phenyl]-2-(4-chlorophenyl)sulfanylpropanamide (PubChem CID 25034802) has the molecular formula C17H17ClN2O4S2 and a molecular weight of 412.92 g/mol. Its IUPAC name is N-[4-(acetylsulfamoyl)phenyl]-2-(4-chlorophenyl)sulfanylpropanamide.
| Compound Name | N-[4-(acetylsulfamoyl)phenyl]-2-(4-chlorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 25034802 |
| Molecular Formula | C17H17ClN2O4S2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | N-[4-(acetylsulfamoyl)phenyl]-2-(4-chlorophenyl)sulfanylpropanamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)C(C)Sc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H17ClN2O4S2/c1-11(25-15-7-3-13(18)4-8-15)17(22)19-14-5-9-16(10-6-14)26(23,24)20-12(2)21/h3-11H,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | FCPGDTLBMYHQKQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |