C12H11ClN2O5S3 — CID 154848330
N-[4-[(4-chlorothiophen-2-yl)sulfonylamino]phenyl]sulfonylacetamide (PubChem CID 154848330) has the molecular formula C12H11ClN2O5S3 and a molecular weight of 394.88 g/mol. Its IUPAC name is N-[4-[(4-chlorothiophen-2-yl)sulfonylamino]phenyl]sulfonylacetamide.
| Compound Name | N-[4-[(4-chlorothiophen-2-yl)sulfonylamino]phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 154848330 |
| Molecular Formula | C12H11ClN2O5S3 |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 393.95 |
| IUPAC Name | N-[4-[(4-chlorothiophen-2-yl)sulfonylamino]phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NS(=O)(=O)c2cc(Cl)cs2)cc1 |
| InChI | InChI=1S/C12H11ClN2O5S3/c1-8(16)14-22(17,18)11-4-2-10(3-5-11)15-23(19,20)12-6-9(13)7-21-12/h2-7,15H,1H3,(H,14,16) |
| InChIKey | SELRBJNCSHGIAB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |