C15H13Cl2N3O4S — CID 4070537
N-[4-[(2,3-dichlorophenyl)carbamoylamino]phenyl]sulfonylacetamide (PubChem CID 4070537) has the molecular formula C15H13Cl2N3O4S and a molecular weight of 402.26 g/mol. Its IUPAC name is N-[4-[(2,3-dichlorophenyl)carbamoylamino]phenyl]sulfonylacetamide.
| Compound Name | N-[4-[(2,3-dichlorophenyl)carbamoylamino]phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 4070537 |
| Molecular Formula | C15H13Cl2N3O4S |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | N-[4-[(2,3-dichlorophenyl)carbamoylamino]phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)Nc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C15H13Cl2N3O4S/c1-9(21)20-25(23,24)11-7-5-10(6-8-11)18-15(22)19-13-4-2-3-12(16)14(13)17/h2-8H,1H3,(H,20,21)(H2,18,19,22) |
| InChIKey | PZXMPPHXLWVTFA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |