C14H14N4O4S — CID 110492034
N-[4-(pyridin-2-ylcarbamoylamino)phenyl]sulfonylacetamide (PubChem CID 110492034) has the molecular formula C14H14N4O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is N-[4-(pyridin-2-ylcarbamoylamino)phenyl]sulfonylacetamide.
| Compound Name | N-[4-(pyridin-2-ylcarbamoylamino)phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 110492034 |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N-[4-(pyridin-2-ylcarbamoylamino)phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C14H14N4O4S/c1-10(19)18-23(21,22)12-7-5-11(6-8-12)16-14(20)17-13-4-2-3-9-15-13/h2-9H,1H3,(H,18,19)(H2,15,16,17,20) |
| InChIKey | SOWCVVUZVOVMFY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |