C20H17Cl2N3O5S2 — CID 2226252
N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-4-(methanesulfonamido)benzamide (PubChem CID 2226252) has the molecular formula C20H17Cl2N3O5S2 and a molecular weight of 514.41 g/mol. Its IUPAC name is N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-4-(methanesulfonamido)benzamide.
| Compound Name | N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-4-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 2226252 |
| Molecular Formula | C20H17Cl2N3O5S2 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 513.00 |
| IUPAC Name | N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-4-(methanesulfonamido)benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)Nc2ccc(S(=O)(=O)Nc3cccc(Cl)c3Cl)cc2)cc1 |
| InChI | InChI=1S/C20H17Cl2N3O5S2/c1-31(27,28)24-15-7-5-13(6-8-15)20(26)23-14-9-11-16(12-10-14)32(29,30)25-18-4-2-3-17(21)19(18)22/h2-12,24-25H,1H3,(H,23,26) |
| InChIKey | UNIOSJGSGVWXLG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |