C25H18Cl2N2O3S — CID 126181507
N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-4-phenylbenzamide (PubChem CID 126181507) has the molecular formula C25H18Cl2N2O3S and a molecular weight of 497.40 g/mol. Its IUPAC name is N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-4-phenylbenzamide.
| Compound Name | N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 126181507 |
| Molecular Formula | C25H18Cl2N2O3S |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-4-phenylbenzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2cccc(Cl)c2Cl)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H18Cl2N2O3S/c26-22-7-4-8-23(24(22)27)29-33(31,32)21-15-13-20(14-16-21)28-25(30)19-11-9-18(10-12-19)17-5-2-1-3-6-17/h1-16,29H,(H,28,30) |
| InChIKey | ZEVQNBXNJQYSGF-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |