C26H21Cl2N3O5S2 — CID 126412707
N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-4-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 126412707) has the molecular formula C26H21Cl2N3O5S2 and a molecular weight of 590.51 g/mol. Its IUPAC name is N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-4-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-4-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 126412707 |
| Molecular Formula | C26H21Cl2N3O5S2 |
| Molecular Weight | 590.51 g/mol |
| Exact Mass | 589.03 |
| IUPAC Name | N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-4-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)Nc3ccc(S(=O)(=O)Nc4cccc(Cl)c4Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H21Cl2N3O5S2/c1-17-5-13-21(14-6-17)37(33,34)30-20-9-7-18(8-10-20)26(32)29-19-11-15-22(16-12-19)38(35,36)31-24-4-2-3-23(27)25(24)28/h2-16,30-31H,1H3,(H,29,32) |
| InChIKey | BTOCALXIMJKIFF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.51 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |