C19H15Cl2N3OS — CID 57150049
1-[4-(4-aminophenyl)sulfanylphenyl]-3-(2,3-dichlorophenyl)urea (PubChem CID 57150049) has the molecular formula C19H15Cl2N3OS and a molecular weight of 404.32 g/mol. Its IUPAC name is 1-[4-(4-aminophenyl)sulfanylphenyl]-3-(2,3-dichlorophenyl)urea.
| Compound Name | 1-[4-(4-aminophenyl)sulfanylphenyl]-3-(2,3-dichlorophenyl)urea |
|---|---|
| PubChem CID | 57150049 |
| Molecular Formula | C19H15Cl2N3OS |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 1-[4-(4-aminophenyl)sulfanylphenyl]-3-(2,3-dichlorophenyl)urea |
| SMILES | Nc1ccc(Sc2ccc(NC(=O)Nc3cccc(Cl)c3Cl)cc2)cc1 |
| InChI | InChI=1S/C19H15Cl2N3OS/c20-16-2-1-3-17(18(16)21)24-19(25)23-13-6-10-15(11-7-13)26-14-8-4-12(22)5-9-14/h1-11H,22H2,(H2,23,24,25) |
| InChIKey | NFGHLPTXMKOGKB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|