C12H10Cl2N2 — CID 4764118
4-N-(2,3-dichlorophenyl)benzene-1,4-diamine (PubChem CID 4764118) has the molecular formula C12H10Cl2N2 and a molecular weight of 253.13 g/mol. Its IUPAC name is 4-N-(2,3-dichlorophenyl)benzene-1,4-diamine.
| Compound Name | 4-N-(2,3-dichlorophenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 4764118 |
| Molecular Formula | C12H10Cl2N2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 4-N-(2,3-dichlorophenyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C12H10Cl2N2/c13-10-2-1-3-11(12(10)14)16-9-6-4-8(15)5-7-9/h1-7,16H,15H2 |
| InChIKey | IOFPWCLWNLTJNE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|