C18H13Cl2N — CID 162720595
2,3-dichloro-N-(4-phenylphenyl)aniline (PubChem CID 162720595) has the molecular formula C18H13Cl2N and a molecular weight of 314.22 g/mol. Its IUPAC name is 2,3-dichloro-N-(4-phenylphenyl)aniline.
| Compound Name | 2,3-dichloro-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 162720595 |
| Molecular Formula | C18H13Cl2N |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 2,3-dichloro-N-(4-phenylphenyl)aniline |
| SMILES | Clc1cccc(Nc2ccc(-c3ccccc3)cc2)c1Cl |
| InChI | InChI=1S/C18H13Cl2N/c19-16-7-4-8-17(18(16)20)21-15-11-9-14(10-12-15)13-5-2-1-3-6-13/h1-12,21H |
| InChIKey | GZZADWNYXYCVNY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |