C12H7Cl2F2N — CID 82536860
2,3-dichloro-N-(3,4-difluorophenyl)aniline (PubChem CID 82536860) has the molecular formula C12H7Cl2F2N and a molecular weight of 274.10 g/mol. Its IUPAC name is 2,3-dichloro-N-(3,4-difluorophenyl)aniline.
| Compound Name | 2,3-dichloro-N-(3,4-difluorophenyl)aniline |
|---|---|
| PubChem CID | 82536860 |
| Molecular Formula | C12H7Cl2F2N |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 2,3-dichloro-N-(3,4-difluorophenyl)aniline |
| SMILES | Fc1ccc(Nc2cccc(Cl)c2Cl)cc1F |
| InChI | InChI=1S/C12H7Cl2F2N/c13-8-2-1-3-11(12(8)14)17-7-4-5-9(15)10(16)6-7/h1-6,17H |
| InChIKey | HNBHZCQLSTUNPS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |