C14H11ClF2N2OS — CID 4852232
1-(2-chlorophenyl)-3-[4-(difluoromethylsulfanyl)phenyl]urea (PubChem CID 4852232) has the molecular formula C14H11ClF2N2OS and a molecular weight of 328.77 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[4-(difluoromethylsulfanyl)phenyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[4-(difluoromethylsulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 4852232 |
| Molecular Formula | C14H11ClF2N2OS |
| Molecular Weight | 328.77 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[4-(difluoromethylsulfanyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(SC(F)F)cc1)Nc1ccccc1Cl |
| InChI | InChI=1S/C14H11ClF2N2OS/c15-11-3-1-2-4-12(11)19-14(20)18-9-5-7-10(8-6-9)21-13(16)17/h1-8,13H,(H2,18,19,20) |
| InChIKey | BFLKXANCRHRZDA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.77 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |