C22H18ClFN2O2S — CID 22778942
N-[4-[1-(2-chloroanilino)-1-oxopropan-2-yl]sulfanylphenyl]-4-fluorobenzamide (PubChem CID 22778942) has the molecular formula C22H18ClFN2O2S and a molecular weight of 428.92 g/mol. Its IUPAC name is N-[4-[1-(2-chloroanilino)-1-oxopropan-2-yl]sulfanylphenyl]-4-fluorobenzamide.
| Compound Name | N-[4-[1-(2-chloroanilino)-1-oxopropan-2-yl]sulfanylphenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 22778942 |
| Molecular Formula | C22H18ClFN2O2S |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | N-[4-[1-(2-chloroanilino)-1-oxopropan-2-yl]sulfanylphenyl]-4-fluorobenzamide |
| SMILES | CC(Sc1ccc(NC(=O)c2ccc(F)cc2)cc1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C22H18ClFN2O2S/c1-14(21(27)26-20-5-3-2-4-19(20)23)29-18-12-10-17(11-13-18)25-22(28)15-6-8-16(24)9-7-15/h2-14H,1H3,(H,25,28)(H,26,27) |
| InChIKey | RBCPUGWQGFUPLU-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |