C17H13ClN2O5S3 — CID 22772945
N-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenyl]sulfonylbenzamide (PubChem CID 22772945) has the molecular formula C17H13ClN2O5S3 and a molecular weight of 456.95 g/mol. Its IUPAC name is N-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenyl]sulfonylbenzamide.
| Compound Name | N-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 22772945 |
| Molecular Formula | C17H13ClN2O5S3 |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 455.97 |
| IUPAC Name | N-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(Cl)s2)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H13ClN2O5S3/c18-15-10-11-16(26-15)28(24,25)19-13-6-8-14(9-7-13)27(22,23)20-17(21)12-4-2-1-3-5-12/h1-11,19H,(H,20,21) |
| InChIKey | DPWFOTTVAYSHPV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |