C18H13ClN4O3S2 — CID 10113684
N-[2-[(5-chlorothiophen-2-yl)sulfonylamino]-3H-benzimidazol-5-yl]benzamide (PubChem CID 10113684) has the molecular formula C18H13ClN4O3S2 and a molecular weight of 432.91 g/mol. Its IUPAC name is N-[2-[(5-chlorothiophen-2-yl)sulfonylamino]-3H-benzimidazol-5-yl]benzamide.
| Compound Name | N-[2-[(5-chlorothiophen-2-yl)sulfonylamino]-3H-benzimidazol-5-yl]benzamide |
|---|---|
| PubChem CID | 10113684 |
| Molecular Formula | C18H13ClN4O3S2 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | N-[2-[(5-chlorothiophen-2-yl)sulfonylamino]-3H-benzimidazol-5-yl]benzamide |
| SMILES | O=C(Nc1ccc2nc(NS(=O)(=O)c3ccc(Cl)s3)[nH]c2c1)c1ccccc1 |
| InChI | InChI=1S/C18H13ClN4O3S2/c19-15-8-9-16(27-15)28(25,26)23-18-21-13-7-6-12(10-14(13)22-18)20-17(24)11-4-2-1-3-5-11/h1-10H,(H,20,24)(H2,21,22,23) |
| InChIKey | WLSLDIZPUCJGPV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |