C18H15ClN2O6S — CID 98085738
N-[4-(acetylsulfamoyl)phenyl]-4-(4-chlorophenyl)-4-hydroxy-2-oxobut-3-enamide (PubChem CID 98085738) has the molecular formula C18H15ClN2O6S and a molecular weight of 422.85 g/mol. Its IUPAC name is N-[4-(acetylsulfamoyl)phenyl]-4-(4-chlorophenyl)-4-hydroxy-2-oxobut-3-enamide.
| Compound Name | N-[4-(acetylsulfamoyl)phenyl]-4-(4-chlorophenyl)-4-hydroxy-2-oxobut-3-enamide |
|---|---|
| PubChem CID | 98085738 |
| Molecular Formula | C18H15ClN2O6S |
| Molecular Weight | 422.85 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | N-[4-(acetylsulfamoyl)phenyl]-4-(4-chlorophenyl)-4-hydroxy-2-oxobut-3-enamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)C(=O)C=C(O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H15ClN2O6S/c1-11(22)21-28(26,27)15-8-6-14(7-9-15)20-18(25)17(24)10-16(23)12-2-4-13(19)5-3-12/h2-10,23H,1H3,(H,20,25)(H,21,22) |
| InChIKey | GNUIYFRUXCYCKQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.85 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|