C20H20N2O7S — CID 78418805
N-[4-(acetylsulfamoyl)phenyl]-4-(4-ethoxyphenyl)-4-hydroxy-2-oxobut-3-enamide (PubChem CID 78418805) has the molecular formula C20H20N2O7S and a molecular weight of 432.45 g/mol. Its IUPAC name is N-[4-(acetylsulfamoyl)phenyl]-4-(4-ethoxyphenyl)-4-hydroxy-2-oxobut-3-enamide.
| Compound Name | N-[4-(acetylsulfamoyl)phenyl]-4-(4-ethoxyphenyl)-4-hydroxy-2-oxobut-3-enamide |
|---|---|
| PubChem CID | 78418805 |
| Molecular Formula | C20H20N2O7S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-[4-(acetylsulfamoyl)phenyl]-4-(4-ethoxyphenyl)-4-hydroxy-2-oxobut-3-enamide |
| SMILES | CCOc1ccc(C(O)=CC(=O)C(=O)Nc2ccc(S(=O)(=O)NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C20H20N2O7S/c1-3-29-16-8-4-14(5-9-16)18(24)12-19(25)20(26)21-15-6-10-17(11-7-15)30(27,28)22-13(2)23/h4-12,24H,3H2,1-2H3,(H,21,26)(H,22,23) |
| InChIKey | ZHEBREJLJVUZFE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|