C8H9ClN2O3S — CID 23501070
2-amino-N-(4-chlorophenyl)sulfonylacetamide (PubChem CID 23501070) has the molecular formula C8H9ClN2O3S and a molecular weight of 248.69 g/mol. Its IUPAC name is 2-amino-N-(4-chlorophenyl)sulfonylacetamide.
| Compound Name | 2-amino-N-(4-chlorophenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 23501070 |
| Molecular Formula | C8H9ClN2O3S |
| Molecular Weight | 248.69 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 2-amino-N-(4-chlorophenyl)sulfonylacetamide |
| SMILES | NCC(=O)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H9ClN2O3S/c9-6-1-3-7(4-2-6)15(13,14)11-8(12)5-10/h1-4H,5,10H2,(H,11,12) |
| InChIKey | CGVCOBLWOACKCS-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.69 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |