C18H20Cl2N2O5S — CID 66935494
(E)-2-(aminomethyl)-N-(4-chlorophenyl)sulfonyl-3-[4-(methoxymethoxy)phenyl]prop-2-enamide;hydrochloride (PubChem CID 66935494) has the molecular formula C18H20Cl2N2O5S and a molecular weight of 447.34 g/mol. Its IUPAC name is (E)-2-(aminomethyl)-N-(4-chlorophenyl)sulfonyl-3-[4-(methoxymethoxy)phenyl]prop-2-enamide;hydrochloride.
| Compound Name | (E)-2-(aminomethyl)-N-(4-chlorophenyl)sulfonyl-3-[4-(methoxymethoxy)phenyl]prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 66935494 |
| Molecular Formula | C18H20Cl2N2O5S |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | (E)-2-(aminomethyl)-N-(4-chlorophenyl)sulfonyl-3-[4-(methoxymethoxy)phenyl]prop-2-enamide;hydrochloride |
| SMILES | COCOc1ccc(/C=C(\CN)C(=O)NS(=O)(=O)c2ccc(Cl)cc2)cc1.Cl |
| InChI | InChI=1S/C18H19ClN2O5S.ClH/c1-25-12-26-16-6-2-13(3-7-16)10-14(11-20)18(22)21-27(23,24)17-8-4-15(19)5-9-17;/h2-10H,11-12,20H2,1H3,(H,21,22);1H/b14-10+; |
| InChIKey | ZQWRLOTXMQOMNK-KMZJGFRYSA-N |
| XLogP | 2.59 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|