C14H25N3O3S — CID 175178486
N-(4-aminophenyl)sulfonylacetamide;N,N-diethylethanamine (PubChem CID 175178486) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is N-(4-aminophenyl)sulfonylacetamide;N,N-diethylethanamine.
| Compound Name | N-(4-aminophenyl)sulfonylacetamide;N,N-diethylethanamine |
|---|---|
| PubChem CID | 175178486 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-(4-aminophenyl)sulfonylacetamide;N,N-diethylethanamine |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(N)cc1.CCN(CC)CC |
| InChI | InChI=1S/C8H10N2O3S.C6H15N/c1-6(11)10-14(12,13)8-4-2-7(9)3-5-8;1-4-7(5-2)6-3/h2-5H,9H2,1H3,(H,10,11);4-6H2,1-3H3 |
| InChIKey | YUNBTTMZYKCDFM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|