C30H58N3O3S+ — CID 69295519
N-(4-aminophenyl)sulfonylacetamide;didecyl(dimethyl)azanium (PubChem CID 69295519) has the molecular formula C30H58N3O3S+ and a molecular weight of 540.88 g/mol. Its IUPAC name is N-(4-aminophenyl)sulfonylacetamide;didecyl(dimethyl)azanium.
| Compound Name | N-(4-aminophenyl)sulfonylacetamide;didecyl(dimethyl)azanium |
|---|---|
| PubChem CID | 69295519 |
| Molecular Formula | C30H58N3O3S+ |
| Molecular Weight | 540.88 g/mol |
| Exact Mass | 540.42 |
| IUPAC Name | N-(4-aminophenyl)sulfonylacetamide;didecyl(dimethyl)azanium |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(N)cc1.CCCCCCCCCC[N+](C)(C)CCCCCCCCCC |
| InChI | InChI=1S/C22H48N.C8H10N2O3S/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;1-6(11)10-14(12,13)8-4-2-7(9)3-5-8/h5-22H2,1-4H3;2-5H,9H2,1H3,(H,10,11)/q+1; |
| InChIKey | NNHDVJAJIGDHJX-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.88 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|