About didecyl(dimethyl)azanium sulfate
didecyl(dimethyl)azanium sulfate (PubChem CID 21195390) has the molecular formula C22H48NO4S-
and a molecular weight of 422.70 g/mol. Its IUPAC name is didecyl(dimethyl)azanium sulfate.
Molecular Properties
| Compound Name | didecyl(dimethyl)azanium sulfate |
| PubChem CID | 21195390 |
| Molecular Formula | C22H48NO4S- |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 422.33 |
| IUPAC Name | didecyl(dimethyl)azanium sulfate |
| SMILES | CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C22H48N.H2O4S/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;1-5(2,3)4/h5-22H2,1-4H3;(H2,1,2,3,4)/q+1;/p-2 |
| InChIKey | QKZSRLQZSFTOHR-UHFFFAOYSA-L |
| XLogP | 6.01 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze didecyl(dimethyl)azanium sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of didecyl(dimethyl)azanium sulfate?
The IUPAC name of didecyl(dimethyl)azanium sulfate (CID 21195390) is didecyl(dimethyl)azanium sulfate.
What is the SMILES notation for didecyl(dimethyl)azanium sulfate?
The canonical SMILES for didecyl(dimethyl)azanium sulfate is CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.O=S(=O)([O-])[O-].
What is the InChIKey of didecyl(dimethyl)azanium sulfate?
The InChIKey is QKZSRLQZSFTOHR-UHFFFAOYSA-L. The full InChI is InChI=1S/C22H48N.H2O4S/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;1-5(2,3)4/h5-22H2,1-4H3;(H2,1,2,3,4)/q+1;/p-2.
What are the key properties of didecyl(dimethyl)azanium sulfate?
didecyl(dimethyl)azanium sulfate has a molecular weight of 422.70 g/mol, XLogP of 6.01, 18 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for didecyl(dimethyl)azanium sulfate is sourced from PubChem (CID 21195390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).