About didecyl(dimethyl)azanium;sulfuric acid
didecyl(dimethyl)azanium;sulfuric acid (PubChem CID 174764452) has the molecular formula C22H52NO8S2+
and a molecular weight of 522.79 g/mol. Its IUPAC name is didecyl(dimethyl)azanium;sulfuric acid.
Molecular Properties
| Compound Name | didecyl(dimethyl)azanium;sulfuric acid |
| PubChem CID | 174764452 |
| Molecular Formula | C22H52NO8S2+ |
| Molecular Weight | 522.79 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | didecyl(dimethyl)azanium;sulfuric acid |
| SMILES | CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.O=S(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C22H48N.2H2O4S/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;2*1-5(2,3)4/h5-22H2,1-4H3;2*(H2,1,2,3,4)/q+1;; |
| InChIKey | OLCSLPCOFFGSSD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.79 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze didecyl(dimethyl)azanium;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of didecyl(dimethyl)azanium;sulfuric acid?
The IUPAC name of didecyl(dimethyl)azanium;sulfuric acid (CID 174764452) is didecyl(dimethyl)azanium;sulfuric acid.
What is the SMILES notation for didecyl(dimethyl)azanium;sulfuric acid?
The canonical SMILES for didecyl(dimethyl)azanium;sulfuric acid is CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.O=S(=O)(O)O.O=S(=O)(O)O.
What is the InChIKey of didecyl(dimethyl)azanium;sulfuric acid?
The InChIKey is OLCSLPCOFFGSSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H48N.2H2O4S/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;2*1-5(2,3)4/h5-22H2,1-4H3;2*(H2,1,2,3,4)/q+1;;.
What are the key properties of didecyl(dimethyl)azanium;sulfuric acid?
didecyl(dimethyl)azanium;sulfuric acid has a molecular weight of 522.79 g/mol, XLogP of 6.04, 18 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for didecyl(dimethyl)azanium;sulfuric acid is sourced from PubChem (CID 174764452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).