About decyl-hexyl-dimethylazanium;hydron;sulfate
decyl-hexyl-dimethylazanium;hydron;sulfate (PubChem CID 134207388) has the molecular formula C18H41NO4S
and a molecular weight of 367.60 g/mol. Its IUPAC name is decyl-hexyl-dimethylazanium;hydron;sulfate.
Molecular Properties
| Compound Name | decyl-hexyl-dimethylazanium;hydron;sulfate |
| PubChem CID | 134207388 |
| Molecular Formula | C18H41NO4S |
| Molecular Weight | 367.60 g/mol |
| Exact Mass | 367.28 |
| IUPAC Name | decyl-hexyl-dimethylazanium;hydron;sulfate |
| SMILES | CCCCCCCCCC[N+](C)(C)CCCCCC.O=S(=O)([O-])[O-].[H+] |
| InChI | InChI=1S/C18H40N.H2O4S/c1-5-7-9-11-12-13-14-16-18-19(3,4)17-15-10-8-6-2;1-5(2,3)4/h5-18H2,1-4H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | UFLLCXBCGBXVDA-UHFFFAOYSA-M |
| XLogP | 4.56 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze decyl-hexyl-dimethylazanium;hydron;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl-hexyl-dimethylazanium;hydron;sulfate?
The IUPAC name of decyl-hexyl-dimethylazanium;hydron;sulfate (CID 134207388) is decyl-hexyl-dimethylazanium;hydron;sulfate.
What is the SMILES notation for decyl-hexyl-dimethylazanium;hydron;sulfate?
The canonical SMILES for decyl-hexyl-dimethylazanium;hydron;sulfate is CCCCCCCCCC[N+](C)(C)CCCCCC.O=S(=O)([O-])[O-].[H+].
What is the InChIKey of decyl-hexyl-dimethylazanium;hydron;sulfate?
The InChIKey is UFLLCXBCGBXVDA-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H40N.H2O4S/c1-5-7-9-11-12-13-14-16-18-19(3,4)17-15-10-8-6-2;1-5(2,3)4/h5-18H2,1-4H3;(H2,1,2,3,4)/q+1;/p-1.
What are the key properties of decyl-hexyl-dimethylazanium;hydron;sulfate?
decyl-hexyl-dimethylazanium;hydron;sulfate has a molecular weight of 367.60 g/mol, XLogP of 4.56, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for decyl-hexyl-dimethylazanium;hydron;sulfate is sourced from PubChem (CID 134207388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).