C8H10KN2O4S+ — CID 20981828
potassium methyl N-(4-aminophenyl)sulfonylcarbamate (PubChem CID 20981828) has the molecular formula C8H10KN2O4S+ and a molecular weight of 269.34 g/mol. Its IUPAC name is potassium methyl N-(4-aminophenyl)sulfonylcarbamate.
| Compound Name | potassium methyl N-(4-aminophenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 20981828 |
| Molecular Formula | C8H10KN2O4S+ |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | potassium methyl N-(4-aminophenyl)sulfonylcarbamate |
| SMILES | COC(=O)NS(=O)(=O)c1ccc(N)cc1.[K+] |
| InChI | InChI=1S/C8H10N2O4S.K/c1-14-8(11)10-15(12,13)7-4-2-6(9)3-5-7;/h2-5H,9H2,1H3,(H,10,11);/q;+1 |
| InChIKey | WKJOGZIRDGAEFO-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|