C19H32N5O10PS — CID 135378810
(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-[hydroxy(methyl)phosphoryl]butanoyl]amino]propanoyl]amino]propanoic acid;methyl N-(4-aminophenyl)sulfonylcarbamate (PubChem CID 135378810) has the molecular formula C19H32N5O10PS and a molecular weight of 553.53 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-amino-4-[hydroxy(methyl)phosphoryl]butanoyl]amino]propanoyl]amino]propanoic acid;methyl N-(4-aminophenyl)sulfonylcarbamate.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-4-[hydroxy(methyl)phosphoryl]butanoyl]amino]propanoyl]amino]propanoic acid;methyl N-(4-aminophenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 135378810 |
| Molecular Formula | C19H32N5O10PS |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-4-[hydroxy(methyl)phosphoryl]butanoyl]amino]propanoyl]amino]propanoic acid;methyl N-(4-aminophenyl)sulfonylcarbamate |
| SMILES | COC(=O)NS(=O)(=O)c1ccc(N)cc1.C[C@H](NC(=O)[C@H](C)NC(=O)[C@@H](N)CCP(C)(=O)O)C(=O)O |
| InChI | InChI=1S/C11H22N3O6P.C8H10N2O4S/c1-6(9(15)14-7(2)11(17)18)13-10(16)8(12)4-5-21(3,19)20;1-14-8(11)10-15(12,13)7-4-2-6(9)3-5-7/h6-8H,4-5,12H2,1-3H3,(H,13,16)(H,14,15)(H,17,18)(H,19,20);2-5H,9H2,1H3,(H,10,11)/t6-,7-,8-;/m0./s1 |
| InChIKey | WCGRYKAAXIMOLO-WQYNNSOESA-N |
| XLogP | -0.99 |
| TPSA | 257.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|