C15H21N3O4 — CID 18223062
2-[2-[(2-amino-3-phenylpropanoyl)amino]propanoylamino]propanoic acid (PubChem CID 18223062) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[2-[(2-amino-3-phenylpropanoyl)amino]propanoylamino]propanoic acid.
| Compound Name | 2-[2-[(2-amino-3-phenylpropanoyl)amino]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 18223062 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-[2-[(2-amino-3-phenylpropanoyl)amino]propanoylamino]propanoic acid |
| SMILES | CC(NC(=O)C(C)NC(=O)C(N)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H21N3O4/c1-9(13(19)18-10(2)15(21)22)17-14(20)12(16)8-11-6-4-3-5-7-11/h3-7,9-10,12H,8,16H2,1-2H3,(H,17,20)(H,18,19)(H,21,22) |
| InChIKey | BJEYSVHMGIJORT-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |