C19H26N4O8 — CID 10181616
(3S)-3-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoyl]amino]-4-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-4-oxobutanoic acid (PubChem CID 10181616) has the molecular formula C19H26N4O8 and a molecular weight of 438.44 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoyl]amino]-4-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoyl]amino]-4-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10181616 |
| Molecular Formula | C19H26N4O8 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoyl]amino]-4-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-4-oxobutanoic acid |
| SMILES | C[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C19H26N4O8/c1-10(21-17(28)12(20)7-11-5-3-2-4-6-11)16(27)22-13(8-15(25)26)18(29)23-14(9-24)19(30)31/h2-6,10,12-14,24H,7-9,20H2,1H3,(H,21,28)(H,22,27)(H,23,29)(H,25,26)(H,30,31)/t10-,12-,13-,14-/m0/s1 |
| InChIKey | MGRKOSBYINTJHZ-PYJNHQTQSA-N |
| XLogP | -2.42 |
| TPSA | 208.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |