C17H23N3O6 — CID 18223065
2-[2-[(2-amino-3-phenylpropanoyl)amino]propanoylamino]pentanedioic acid (PubChem CID 18223065) has the molecular formula C17H23N3O6 and a molecular weight of 365.39 g/mol. Its IUPAC name is 2-[2-[(2-amino-3-phenylpropanoyl)amino]propanoylamino]pentanedioic acid.
| Compound Name | 2-[2-[(2-amino-3-phenylpropanoyl)amino]propanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 18223065 |
| Molecular Formula | C17H23N3O6 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 2-[2-[(2-amino-3-phenylpropanoyl)amino]propanoylamino]pentanedioic acid |
| SMILES | CC(NC(=O)C(N)Cc1ccccc1)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H23N3O6/c1-10(15(23)20-13(17(25)26)7-8-14(21)22)19-16(24)12(18)9-11-5-3-2-4-6-11/h2-6,10,12-13H,7-9,18H2,1H3,(H,19,24)(H,20,23)(H,21,22)(H,25,26) |
| InChIKey | CYZBFPYMSJGBRL-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |