C14H22N3O5P — CID 54374404
[(1R)-1-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoyl]amino]ethyl]phosphonic acid (PubChem CID 54374404) has the molecular formula C14H22N3O5P and a molecular weight of 343.32 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoyl]amino]ethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoyl]amino]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 54374404 |
| Molecular Formula | C14H22N3O5P |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | [(1R)-1-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoyl]amino]ethyl]phosphonic acid |
| SMILES | C[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)N[C@@H](C)P(=O)(O)O |
| InChI | InChI=1S/C14H22N3O5P/c1-9(13(18)17-10(2)23(20,21)22)16-14(19)12(15)8-11-6-4-3-5-7-11/h3-7,9-10,12H,8,15H2,1-2H3,(H,16,19)(H,17,18)(H2,20,21,22)/t9-,10+,12-/m0/s1 |
| InChIKey | UVLRGBDQNXCGSC-UMNHJUIQSA-N |
| XLogP | -0.30 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|