C24H25N2O4P — CID 70142216
diphenylphosphoryl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoate (PubChem CID 70142216) has the molecular formula C24H25N2O4P and a molecular weight of 436.45 g/mol. Its IUPAC name is diphenylphosphoryl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoate.
| Compound Name | diphenylphosphoryl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoate |
|---|---|
| PubChem CID | 70142216 |
| Molecular Formula | C24H25N2O4P |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | diphenylphosphoryl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)OP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25N2O4P/c1-18(26-23(27)22(25)17-19-11-5-2-6-12-19)24(28)30-31(29,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,18,22H,17,25H2,1H3,(H,26,27)/t18-,22-/m0/s1 |
| InChIKey | MDYXCUFGHKZYKV-AVRDEDQJSA-N |
| XLogP | 2.53 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|