C14H19BrN2O3 — CID 70619244
2-bromoethyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoate (PubChem CID 70619244) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is 2-bromoethyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoate.
| Compound Name | 2-bromoethyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoate |
|---|---|
| PubChem CID | 70619244 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-bromoethyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)OCCBr |
| InChI | InChI=1S/C14H19BrN2O3/c1-10(14(19)20-8-7-15)17-13(18)12(16)9-11-5-3-2-4-6-11/h2-6,10,12H,7-9,16H2,1H3,(H,17,18)/t10-,12-/m0/s1 |
| InChIKey | BVUALPDPQDVOKY-JQWIXIFHSA-N |
| XLogP | 1.00 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|