C5H13NNaO4P — CID 173033369
sodium;2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;hydride (PubChem CID 173033369) has the molecular formula C5H13NNaO4P and a molecular weight of 205.13 g/mol. Its IUPAC name is sodium;2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;hydride.
| Compound Name | sodium;2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;hydride |
|---|---|
| PubChem CID | 173033369 |
| Molecular Formula | C5H13NNaO4P |
| Molecular Weight | 205.13 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | sodium;2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;hydride |
| SMILES | CP(=O)(O)CCC(N)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C5H12NO4P.Na.H/c1-11(9,10)3-2-4(6)5(7)8;;/h4H,2-3,6H2,1H3,(H,7,8)(H,9,10);;/q;+1;-1 |
| InChIKey | WFSRHFDOMSRTMN-UHFFFAOYSA-N |
| XLogP | -3.19 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.13 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|