C5H11NO5P- — CID 24794417
[(4R)-4-amino-4-carboxybutyl]-hydroxyphosphinate (PubChem CID 24794417) has the molecular formula C5H11NO5P- and a molecular weight of 196.12 g/mol. Its IUPAC name is [(4R)-4-amino-4-carboxybutyl]-hydroxyphosphinate.
| Compound Name | [(4R)-4-amino-4-carboxybutyl]-hydroxyphosphinate |
|---|---|
| PubChem CID | 24794417 |
| Molecular Formula | C5H11NO5P- |
| Molecular Weight | 196.12 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | [(4R)-4-amino-4-carboxybutyl]-hydroxyphosphinate |
| SMILES | N[C@H](CCCP(=O)([O-])O)C(=O)O |
| InChI | InChI=1S/C5H12NO5P/c6-4(5(7)8)2-1-3-12(9,10)11/h4H,1-3,6H2,(H,7,8)(H2,9,10,11)/p-1/t4-/m1/s1 |
| InChIKey | VOROEQBFPPIACJ-SCSAIBSYSA-M |
| XLogP | -1.28 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.12 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|