C5H15N2O4P — CID 13034856
(2S)-2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;azane (PubChem CID 13034856) has the molecular formula C5H15N2O4P and a molecular weight of 198.16 g/mol. Its IUPAC name is (2S)-2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;azane.
| Compound Name | (2S)-2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;azane |
|---|---|
| PubChem CID | 13034856 |
| Molecular Formula | C5H15N2O4P |
| Molecular Weight | 198.16 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | (2S)-2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;azane |
| SMILES | CP(=O)(O)CC[C@H](N)C(=O)O.N |
| InChI | InChI=1S/C5H12NO4P.H3N/c1-11(9,10)3-2-4(6)5(7)8;/h4H,2-3,6H2,1H3,(H,7,8)(H,9,10);1H3/t4-;/m0./s1 |
| InChIKey | ZBMRKNMTMPPMMK-WCCKRBBISA-N |
| XLogP | -0.15 |
| TPSA | 135.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.16 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|