C6H12NO6P — CID 88946059
2-(carboxyamino)-4-[hydroxy(methyl)phosphoryl]butanoic acid (PubChem CID 88946059) has the molecular formula C6H12NO6P and a molecular weight of 225.14 g/mol. Its IUPAC name is 2-(carboxyamino)-4-[hydroxy(methyl)phosphoryl]butanoic acid.
| Compound Name | 2-(carboxyamino)-4-[hydroxy(methyl)phosphoryl]butanoic acid |
|---|---|
| PubChem CID | 88946059 |
| Molecular Formula | C6H12NO6P |
| Molecular Weight | 225.14 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 2-(carboxyamino)-4-[hydroxy(methyl)phosphoryl]butanoic acid |
| SMILES | CP(=O)(O)CCC(NC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H12NO6P/c1-14(12,13)3-2-4(5(8)9)7-6(10)11/h4,7H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13) |
| InChIKey | KNTRFGJKZLSHLH-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.14 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|