C10H26N2O6P2 — CID 88602394
3-aminobutyl(methyl)phosphinic acid;2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid (PubChem CID 88602394) has the molecular formula C10H26N2O6P2 and a molecular weight of 332.27 g/mol. Its IUPAC name is 3-aminobutyl(methyl)phosphinic acid;2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid.
| Compound Name | 3-aminobutyl(methyl)phosphinic acid;2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid |
|---|---|
| PubChem CID | 88602394 |
| Molecular Formula | C10H26N2O6P2 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-aminobutyl(methyl)phosphinic acid;2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid |
| SMILES | CC(N)CCP(C)(=O)O.CP(=O)(O)CCC(N)C(=O)O |
| InChI | InChI=1S/C5H12NO4P.C5H14NO2P/c1-11(9,10)3-2-4(6)5(7)8;1-5(6)3-4-9(2,7)8/h4H,2-3,6H2,1H3,(H,7,8)(H,9,10);5H,3-4,6H2,1-2H3,(H,7,8) |
| InChIKey | GKHUYDPOGNSCGH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|