C5H15Cl2N2O4P — CID 11499981
(2S)-2-amino-4-[aminomethyl(hydroxy)phosphoryl]butanoic acid;dihydrochloride (PubChem CID 11499981) has the molecular formula C5H15Cl2N2O4P and a molecular weight of 269.06 g/mol. Its IUPAC name is (2S)-2-amino-4-[aminomethyl(hydroxy)phosphoryl]butanoic acid;dihydrochloride.
| Compound Name | (2S)-2-amino-4-[aminomethyl(hydroxy)phosphoryl]butanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 11499981 |
| Molecular Formula | C5H15Cl2N2O4P |
| Molecular Weight | 269.06 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | (2S)-2-amino-4-[aminomethyl(hydroxy)phosphoryl]butanoic acid;dihydrochloride |
| SMILES | Cl.Cl.NCP(=O)(O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H13N2O4P.2ClH/c6-3-12(10,11)2-1-4(7)5(8)9;;/h4H,1-3,6-7H2,(H,8,9)(H,10,11);2*1H/t4-;;/m0../s1 |
| InChIKey | MNFMFCIMPIAWKD-FHNDMYTFSA-N |
| XLogP | -0.18 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.06 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|