C6H13N2O5P — CID 167231881
(2R)-2-(carbamoylamino)-4-[hydroxy(methyl)phosphoryl]butanoic acid (PubChem CID 167231881) has the molecular formula C6H13N2O5P and a molecular weight of 224.15 g/mol. Its IUPAC name is (2R)-2-(carbamoylamino)-4-[hydroxy(methyl)phosphoryl]butanoic acid.
| Compound Name | (2R)-2-(carbamoylamino)-4-[hydroxy(methyl)phosphoryl]butanoic acid |
|---|---|
| PubChem CID | 167231881 |
| Molecular Formula | C6H13N2O5P |
| Molecular Weight | 224.15 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | (2R)-2-(carbamoylamino)-4-[hydroxy(methyl)phosphoryl]butanoic acid |
| SMILES | CP(=O)(O)CC[C@@H](NC(N)=O)C(=O)O |
| InChI | InChI=1S/C6H13N2O5P/c1-14(12,13)3-2-4(5(9)10)8-6(7)11/h4H,2-3H2,1H3,(H,9,10)(H,12,13)(H3,7,8,11)/t4-/m1/s1 |
| InChIKey | NVVIWKGOHBKRBD-SCSAIBSYSA-N |
| XLogP | -0.60 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.15 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|