C6H12N2O6 — CID 141207509
(2S)-2-(carbamoylamino)pentanedioic acid;hydrate (PubChem CID 141207509) has the molecular formula C6H12N2O6 and a molecular weight of 208.17 g/mol. Its IUPAC name is (2S)-2-(carbamoylamino)pentanedioic acid;hydrate.
| Compound Name | (2S)-2-(carbamoylamino)pentanedioic acid;hydrate |
|---|---|
| PubChem CID | 141207509 |
| Molecular Formula | C6H12N2O6 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (2S)-2-(carbamoylamino)pentanedioic acid;hydrate |
| SMILES | NC(=O)N[C@@H](CCC(=O)O)C(=O)O.O |
| InChI | InChI=1S/C6H10N2O5.H2O/c7-6(13)8-3(5(11)12)1-2-4(9)10;/h3H,1-2H2,(H,9,10)(H,11,12)(H3,7,8,13);1H2/t3-;/m0./s1 |
| InChIKey | DWVLGDCWEFKKQL-DFWYDOINSA-N |
| XLogP | -1.85 |
| TPSA | 161.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |