C7H10ClNO6 — CID 150490769
2-(chloromethoxycarbonylamino)pentanedioic acid (PubChem CID 150490769) has the molecular formula C7H10ClNO6 and a molecular weight of 239.61 g/mol. Its IUPAC name is 2-(chloromethoxycarbonylamino)pentanedioic acid.
| Compound Name | 2-(chloromethoxycarbonylamino)pentanedioic acid |
|---|---|
| PubChem CID | 150490769 |
| Molecular Formula | C7H10ClNO6 |
| Molecular Weight | 239.61 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 2-(chloromethoxycarbonylamino)pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)OCCl)C(=O)O |
| InChI | InChI=1S/C7H10ClNO6/c8-3-15-7(14)9-4(6(12)13)1-2-5(10)11/h4H,1-3H2,(H,9,14)(H,10,11)(H,12,13) |
| InChIKey | HVTFDCKUGIJNNQ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.61 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|