C8H11Cl3N2O5 — CID 175302418
5-amino-5-oxo-2-(2,2,2-trichloroethoxycarbonylamino)pentanoic acid (PubChem CID 175302418) has the molecular formula C8H11Cl3N2O5 and a molecular weight of 321.54 g/mol. Its IUPAC name is 5-amino-5-oxo-2-(2,2,2-trichloroethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-amino-5-oxo-2-(2,2,2-trichloroethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 175302418 |
| Molecular Formula | C8H11Cl3N2O5 |
| Molecular Weight | 321.54 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 5-amino-5-oxo-2-(2,2,2-trichloroethoxycarbonylamino)pentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)OCC(Cl)(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C8H11Cl3N2O5/c9-8(10,11)3-18-7(17)13-4(6(15)16)1-2-5(12)14/h4H,1-3H2,(H2,12,14)(H,13,17)(H,15,16) |
| InChIKey | QHETWWSJSILTNX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.54 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|