C8H10Cl3NO6 — CID 10980221
2-(2,2,2-trichloroethoxycarbonylamino)pentanedioic acid (PubChem CID 10980221) has the molecular formula C8H10Cl3NO6 and a molecular weight of 322.53 g/mol. Its IUPAC name is 2-(2,2,2-trichloroethoxycarbonylamino)pentanedioic acid.
| Compound Name | 2-(2,2,2-trichloroethoxycarbonylamino)pentanedioic acid |
|---|---|
| PubChem CID | 10980221 |
| Molecular Formula | C8H10Cl3NO6 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | 2-(2,2,2-trichloroethoxycarbonylamino)pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)OCC(Cl)(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C8H10Cl3NO6/c9-8(10,11)3-18-7(17)12-4(6(15)16)1-2-5(13)14/h4H,1-3H2,(H,12,17)(H,13,14)(H,15,16) |
| InChIKey | SWBDDIBYRSGODO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|